| Name | 1,3-Dibutyl-2-thiourea |
| Synonyms | Pennzone B n,n'-dibutyl-thioure 1,3-dibutyl-2-thio-ure 1,3-Dibutyl-2-thiourea N,N'-Di-n-butylthiourea 1,3-Di-N-butyl-2-thiourea DBTU(1,3-dibutylthiourea) N,N'-di-Normal-butylthiourea 1,3-Dibutyl-2-thiourea ( DBTU ) |
| CAS | 109-46-6 |
| EINECS | 203-674-6 |
| InChI | InChI=1/C9H20N2S/c1-3-5-7-10-9(12)11-8-6-4-2/h3-8H2,1-2H3,(H2,10,11,12) |
| Molecular Formula | C9H20N2S |
| Molar Mass | 188.33 |
| Density | 0.9893 (rough estimate) |
| Melting Point | 63-65°C(lit.) |
| Boling Point | 122 °C / 14mmHg |
| Flash Point | 105.9°C |
| Water Solubility | slightly soluble |
| Solubility | within almost transparency in Methanol |
| Vapor Presure | 0.0032 hPa (25 °C) |
| Appearance | powder to crystal |
| Color | White to Light yellow |
| BRN | 507434 |
| pKa | 14.30±0.70(Predicted) |
| PH | 6 (0.2g/l, H2O, 20℃) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.5500 (estimate) |
| MDL | MFCD00004926 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S36/37 - Wear suitable protective clothing and gloves. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | YS8400000 |
| TSCA | Yes |
| HS Code | 29309070 |
| Hazard Class | IRRITANT |
| Toxicity | LD50 orally in Rabbit: 350 mg/kg |
| LogP | 2.75 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |